C23H24Cl2N2O4 — CID 4297382
methyl 4-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2-methoxyethyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 4297382) has the molecular formula C23H24Cl2N2O4 and a molecular weight of 463.36 g/mol. Its IUPAC name is methyl 4-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2-methoxyethyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl 4-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2-methoxyethyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4297382 |
| Molecular Formula | C23H24Cl2N2O4 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | methyl 4-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2-methoxyethyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COCCN1C(=O)C(=Cc2cc(C)n(-c3ccc(Cl)cc3Cl)c2C)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C23H24Cl2N2O4/c1-13-10-16(14(2)27(13)20-7-6-17(24)12-19(20)25)11-18-21(23(29)31-5)15(3)26(22(18)28)8-9-30-4/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | XYEHJHJZCLGVDG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|