C28H30N6OS2 — CID 10186781
4-cyclohexyl-5-[2-[3-(3-imidazol-1-ylpropoxy)anilino]pyrimidin-4-yl]-2-methylsulfanylthiophene-3-carbonitrile (PubChem CID 10186781) has the molecular formula C28H30N6OS2 and a molecular weight of 530.72 g/mol. Its IUPAC name is 4-cyclohexyl-5-[2-[3-(3-imidazol-1-ylpropoxy)anilino]pyrimidin-4-yl]-2-methylsulfanylthiophene-3-carbonitrile.
| Compound Name | 4-cyclohexyl-5-[2-[3-(3-imidazol-1-ylpropoxy)anilino]pyrimidin-4-yl]-2-methylsulfanylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 10186781 |
| Molecular Formula | C28H30N6OS2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 4-cyclohexyl-5-[2-[3-(3-imidazol-1-ylpropoxy)anilino]pyrimidin-4-yl]-2-methylsulfanylthiophene-3-carbonitrile |
| SMILES | CSc1sc(-c2ccnc(Nc3cccc(OCCCn4ccnc4)c3)n2)c(C2CCCCC2)c1C#N |
| InChI | InChI=1S/C28H30N6OS2/c1-36-27-23(18-29)25(20-7-3-2-4-8-20)26(37-27)24-11-12-31-28(33-24)32-21-9-5-10-22(17-21)35-16-6-14-34-15-13-30-19-34/h5,9-13,15,17,19-20H,2-4,6-8,14,16H2,1H3,(H,31,32,33) |
| InChIKey | CWQCBTWLIOIHGX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|