C26H29F3N4O3S — CID 10186942
3-methyl-N-[6-[3-(propan-2-ylsulfonylamino)propylamino]-3-pyridinyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 10186942) has the molecular formula C26H29F3N4O3S and a molecular weight of 534.60 g/mol. Its IUPAC name is 3-methyl-N-[6-[3-(propan-2-ylsulfonylamino)propylamino]-3-pyridinyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-methyl-N-[6-[3-(propan-2-ylsulfonylamino)propylamino]-3-pyridinyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10186942 |
| Molecular Formula | C26H29F3N4O3S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 3-methyl-N-[6-[3-(propan-2-ylsulfonylamino)propylamino]-3-pyridinyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NCCCNS(=O)(=O)C(C)C)nc2)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H29F3N4O3S/c1-17(2)37(35,36)32-15-5-14-30-23-13-12-21(16-31-23)33-25(34)22-7-4-6-18(3)24(22)19-8-10-20(11-9-19)26(27,28)29/h4,6-13,16-17,32H,5,14-15H2,1-3H3,(H,30,31)(H,33,34) |
| InChIKey | NCXRPCFVLKMPED-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|