C28H25F8NO2 — CID 10187819
(2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol (PubChem CID 10187819) has the molecular formula C28H25F8NO2 and a molecular weight of 559.50 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol |
|---|---|
| PubChem CID | 10187819 |
| Molecular Formula | C28H25F8NO2 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol |
| SMILES | O[C@H](CN(Cc1cccc(C(F)(F)C(F)(F)F)c1)c1cccc(Oc2ccc3c(c2)CCCC3)c1)C(F)(F)F |
| InChI | InChI=1S/C28H25F8NO2/c29-26(30,28(34,35)36)21-8-3-5-18(13-21)16-37(17-25(38)27(31,32)33)22-9-4-10-23(15-22)39-24-12-11-19-6-1-2-7-20(19)14-24/h3-5,8-15,25,38H,1-2,6-7,16-17H2/t25-/m1/s1 |
| InChIKey | QLKFFVYKPJREMZ-RUZDIDTESA-N |
| XLogP | 7.94 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|