C34H33N3O3 — CID 1018944
(6R,9R)-5-benzoyl-9-[4-(diethylamino)phenyl]-6-(furan-2-yl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 1018944) has the molecular formula C34H33N3O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is (6R,9R)-5-benzoyl-9-[4-(diethylamino)phenyl]-6-(furan-2-yl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9R)-5-benzoyl-9-[4-(diethylamino)phenyl]-6-(furan-2-yl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 1018944 |
| Molecular Formula | C34H33N3O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | (6R,9R)-5-benzoyl-9-[4-(diethylamino)phenyl]-6-(furan-2-yl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCN(CC)c1ccc([C@H]2CC(=O)C3=C(C2)Nc2ccccc2N(C(=O)c2ccccc2)[C@H]3c2ccco2)cc1 |
| InChI | InChI=1S/C34H33N3O3/c1-3-36(4-2)26-18-16-23(17-19-26)25-21-28-32(30(38)22-25)33(31-15-10-20-40-31)37(29-14-9-8-13-27(29)35-28)34(39)24-11-6-5-7-12-24/h5-20,25,33,35H,3-4,21-22H2,1-2H3/t25-,33+/m1/s1 |
| InChIKey | GHTITRMZLWOIJC-HPMVVLTCSA-N |
| XLogP | 7.34 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|