C33H39N3O3 — CID 3134417
6-[4-(diethylamino)phenyl]-9-(furan-2-yl)-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 3134417) has the molecular formula C33H39N3O3 and a molecular weight of 525.69 g/mol. Its IUPAC name is 6-[4-(diethylamino)phenyl]-9-(furan-2-yl)-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-[4-(diethylamino)phenyl]-9-(furan-2-yl)-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3134417 |
| Molecular Formula | C33H39N3O3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 6-[4-(diethylamino)phenyl]-9-(furan-2-yl)-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCCCC(=O)N1c2ccccc2NC2=C(C(=O)CC(c3ccco3)C2)C1c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C33H39N3O3/c1-4-7-8-15-31(38)36-28-13-10-9-12-26(28)34-27-21-24(30-14-11-20-39-30)22-29(37)32(27)33(36)23-16-18-25(19-17-23)35(5-2)6-3/h9-14,16-20,24,33-34H,4-8,15,21-22H2,1-3H3 |
| InChIKey | QKEXHEXLFRRNBI-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|