C35H41N3O2 — CID 40733263
(6R,9S)-6-[4-(diethylamino)phenyl]-5-hexanoyl-9-phenyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 40733263) has the molecular formula C35H41N3O2 and a molecular weight of 535.73 g/mol. Its IUPAC name is (6R,9S)-6-[4-(diethylamino)phenyl]-5-hexanoyl-9-phenyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9S)-6-[4-(diethylamino)phenyl]-5-hexanoyl-9-phenyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 40733263 |
| Molecular Formula | C35H41N3O2 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | (6R,9S)-6-[4-(diethylamino)phenyl]-5-hexanoyl-9-phenyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCCCC(=O)N1c2ccccc2NC2=C(C(=O)C[C@@H](c3ccccc3)C2)[C@H]1c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C35H41N3O2/c1-4-7-9-18-33(40)38-31-17-13-12-16-29(31)36-30-23-27(25-14-10-8-11-15-25)24-32(39)34(30)35(38)26-19-21-28(22-20-26)37(5-2)6-3/h8,10-17,19-22,27,35-36H,4-7,9,18,23-24H2,1-3H3/t27-,35+/m0/s1 |
| InChIKey | MRSGGROIUGJYID-JCVFDAPQSA-N |
| XLogP | 8.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|