C36H51N3O8 — CID 10189806
triethyl 3-[1-[2-[4-[furan-2-carbonyl-(5-methyl-2-pyridinyl)amino]piperidin-1-yl]ethyl]cyclohexyl]propane-1,1,1-tricarboxylate (PubChem CID 10189806) has the molecular formula C36H51N3O8 and a molecular weight of 653.82 g/mol. Its IUPAC name is triethyl 3-[1-[2-[4-[furan-2-carbonyl-(5-methyl-2-pyridinyl)amino]piperidin-1-yl]ethyl]cyclohexyl]propane-1,1,1-tricarboxylate.
| Compound Name | triethyl 3-[1-[2-[4-[furan-2-carbonyl-(5-methyl-2-pyridinyl)amino]piperidin-1-yl]ethyl]cyclohexyl]propane-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 10189806 |
| Molecular Formula | C36H51N3O8 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | triethyl 3-[1-[2-[4-[furan-2-carbonyl-(5-methyl-2-pyridinyl)amino]piperidin-1-yl]ethyl]cyclohexyl]propane-1,1,1-tricarboxylate |
| SMILES | CCOC(=O)C(CCC1(CCN2CCC(N(C(=O)c3ccco3)c3ccc(C)cn3)CC2)CCCCC1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C36H51N3O8/c1-5-44-32(41)36(33(42)45-6-2,34(43)46-7-3)20-19-35(17-9-8-10-18-35)21-24-38-22-15-28(16-23-38)39(30-14-13-27(4)26-37-30)31(40)29-12-11-25-47-29/h11-14,25-26,28H,5-10,15-24H2,1-4H3 |
| InChIKey | LRGTXGWBWAZOMM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 128.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|