C28H39N3O3 — CID 174441634
N-[1-[2-[1-(3-hydroxyiminopropyl)cyclohexyl]ethyl]piperidin-4-yl]-N-(4-methylphenyl)furan-2-carboxamide (PubChem CID 174441634) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-[1-[2-[1-(3-hydroxyiminopropyl)cyclohexyl]ethyl]piperidin-4-yl]-N-(4-methylphenyl)furan-2-carboxamide.
| Compound Name | N-[1-[2-[1-(3-hydroxyiminopropyl)cyclohexyl]ethyl]piperidin-4-yl]-N-(4-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 174441634 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | N-[1-[2-[1-(3-hydroxyiminopropyl)cyclohexyl]ethyl]piperidin-4-yl]-N-(4-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(N(C(=O)c2ccco2)C2CCN(CCC3(CCC=NO)CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C28H39N3O3/c1-23-8-10-24(11-9-23)31(27(32)26-7-5-22-34-26)25-12-19-30(20-13-25)21-17-28(16-6-18-29-33)14-3-2-4-15-28/h5,7-11,18,22,25,33H,2-4,6,12-17,19-21H2,1H3 |
| InChIKey | CINGBLIMUIXPDF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|