C21H32N2O4 — CID 11383314
2-[1-[2-[4-[furan-2-carbonyl(methyl)amino]piperidin-1-yl]ethyl]cyclohexyl]acetic acid (PubChem CID 11383314) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[1-[2-[4-[furan-2-carbonyl(methyl)amino]piperidin-1-yl]ethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-[4-[furan-2-carbonyl(methyl)amino]piperidin-1-yl]ethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 11383314 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-[1-[2-[4-[furan-2-carbonyl(methyl)amino]piperidin-1-yl]ethyl]cyclohexyl]acetic acid |
| SMILES | CN(C(=O)c1ccco1)C1CCN(CCC2(CC(=O)O)CCCCC2)CC1 |
| InChI | InChI=1S/C21H32N2O4/c1-22(20(26)18-6-5-15-27-18)17-7-12-23(13-8-17)14-11-21(16-19(24)25)9-3-2-4-10-21/h5-6,15,17H,2-4,7-14,16H2,1H3,(H,24,25) |
| InChIKey | WZRIOTFMJDZLBS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |