C17H19ClO5 — CID 10193473
5-[5-(4-chlorophenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one (PubChem CID 10193473) has the molecular formula C17H19ClO5 and a molecular weight of 338.79 g/mol. Its IUPAC name is 5-[5-(4-chlorophenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one.
| Compound Name | 5-[5-(4-chlorophenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one |
|---|---|
| PubChem CID | 10193473 |
| Molecular Formula | C17H19ClO5 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 5-[5-(4-chlorophenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one |
| SMILES | O=c1cc(CO)occ1OCCCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClO5/c18-13-4-6-14(7-5-13)21-8-2-1-3-9-22-17-12-23-15(11-19)10-16(17)20/h4-7,10,12,19H,1-3,8-9,11H2 |
| InChIKey | ZREPZXAHSQCJOX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|