C22H27N5 — CID 10193750
N-(1H-benzimidazol-2-ylmethyl)-2-methylidene-N-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine (PubChem CID 10193750) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-methylidene-N-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-methylidene-N-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 10193750 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-methylidene-N-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
| SMILES | C=C(CCN)CN(Cc1nc2ccccc2[nH]1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C22H27N5/c1-16(11-12-23)14-27(15-21-25-18-8-2-3-9-19(18)26-21)20-10-4-6-17-7-5-13-24-22(17)20/h2-3,5,7-9,13,20H,1,4,6,10-12,14-15,23H2,(H,25,26) |
| InChIKey | DMQXYCWLZAMGFV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|