C21H26N6O — CID 59694175
3-[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]propylurea (PubChem CID 59694175) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]propylurea.
| Compound Name | 3-[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]propylurea |
|---|---|
| PubChem CID | 59694175 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 3-[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]propylurea |
| SMILES | NC(=O)NCCCN(Cc1nc2ccccc2[nH]1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C21H26N6O/c22-21(28)24-12-5-13-27(14-19-25-16-8-1-2-9-17(16)26-19)18-10-3-6-15-7-4-11-23-20(15)18/h1-2,4,7-9,11,18H,3,5-6,10,12-14H2,(H,25,26)(H3,22,24,28) |
| InChIKey | RWKIYAQSJPIZLR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|