C22H28ClN5O — CID 141259205
methyl 4-[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]butanimidate;hydrochloride (PubChem CID 141259205) has the molecular formula C22H28ClN5O and a molecular weight of 413.95 g/mol. Its IUPAC name is methyl 4-[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]butanimidate;hydrochloride.
| Compound Name | methyl 4-[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]butanimidate;hydrochloride |
|---|---|
| PubChem CID | 141259205 |
| Molecular Formula | C22H28ClN5O |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl 4-[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]butanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(/CCCN(Cc1nc2ccccc2[nH]1)C1CCCc2cccnc21)OC |
| InChI | InChI=1S/C22H27N5O.ClH/c1-28-20(23)12-6-14-27(15-21-25-17-9-2-3-10-18(17)26-21)19-11-4-7-16-8-5-13-24-22(16)19;/h2-3,5,8-10,13,19,23H,4,6-7,11-12,14-15H2,1H3,(H,25,26);1H/b23-20-; |
| InChIKey | OQLZNBYXFMFHRN-QTXBERLJSA-N |
| XLogP | 4.66 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|