C20H30N2O3S — CID 10193969
N-[(2R)-3-[tert-butyl(propyl)amino]-2-hydroxypropyl]naphthalene-1-sulfonamide (PubChem CID 10193969) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[(2R)-3-[tert-butyl(propyl)amino]-2-hydroxypropyl]naphthalene-1-sulfonamide.
| Compound Name | N-[(2R)-3-[tert-butyl(propyl)amino]-2-hydroxypropyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 10193969 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-[(2R)-3-[tert-butyl(propyl)amino]-2-hydroxypropyl]naphthalene-1-sulfonamide |
| SMILES | CCCN(C[C@@H](O)CNS(=O)(=O)c1cccc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C20H30N2O3S/c1-5-13-22(20(2,3)4)15-17(23)14-21-26(24,25)19-12-8-10-16-9-6-7-11-18(16)19/h6-12,17,21,23H,5,13-15H2,1-4H3/t17-/m0/s1 |
| InChIKey | QEICWEJXHSYJEP-KRWDZBQOSA-N |
| XLogP | 2.99 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |