C15H13Br2NO — CID 1019458
2,5-dibromo-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 1019458) has the molecular formula C15H13Br2NO and a molecular weight of 383.08 g/mol. Its IUPAC name is 2,5-dibromo-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2,5-dibromo-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 1019458 |
| Molecular Formula | C15H13Br2NO |
| Molecular Weight | 383.08 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 2,5-dibromo-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1cc(Br)ccc1Br)c1ccccc1 |
| InChI | InChI=1S/C15H13Br2NO/c1-10(11-5-3-2-4-6-11)18-15(19)13-9-12(16)7-8-14(13)17/h2-10H,1H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | IBGCTMSFAXDDHR-JTQLQIEISA-N |
| XLogP | 4.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.08 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |