C25H29N5O3 — CID 10195094
1-(3-amino-3-oxopropyl)-2-benzamido-N-cyclohexyl-N-methylbenzimidazole-5-carboxamide (PubChem CID 10195094) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-(3-amino-3-oxopropyl)-2-benzamido-N-cyclohexyl-N-methylbenzimidazole-5-carboxamide.
| Compound Name | 1-(3-amino-3-oxopropyl)-2-benzamido-N-cyclohexyl-N-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 10195094 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-(3-amino-3-oxopropyl)-2-benzamido-N-cyclohexyl-N-methylbenzimidazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)nc(NC(=O)c1ccccc1)n2CCC(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C25H29N5O3/c1-29(19-10-6-3-7-11-19)24(33)18-12-13-21-20(16-18)27-25(30(21)15-14-22(26)31)28-23(32)17-8-4-2-5-9-17/h2,4-5,8-9,12-13,16,19H,3,6-7,10-11,14-15H2,1H3,(H2,26,31)(H,27,28,32) |
| InChIKey | NSSNPHNDZBWWAR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |