C28H24N4O2 — CID 10195107
4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-(3-ethoxyphenyl)benzonitrile (PubChem CID 10195107) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-(3-ethoxyphenyl)benzonitrile.
| Compound Name | 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-(3-ethoxyphenyl)benzonitrile |
|---|---|
| PubChem CID | 10195107 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-(3-ethoxyphenyl)benzonitrile |
| SMILES | CCOc1cccc(-c2cc(C#N)ccc2COC(c2ccc(C#N)cc2)c2cncn2C)c1 |
| InChI | InChI=1S/C28H24N4O2/c1-3-33-25-6-4-5-23(14-25)26-13-21(16-30)9-12-24(26)18-34-28(27-17-31-19-32(27)2)22-10-7-20(15-29)8-11-22/h4-14,17,19,28H,3,18H2,1-2H3 |
| InChIKey | DQULASPPLJLHJJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 83.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |