C30H22N4O — CID 11340002
4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-naphthalen-1-ylbenzonitrile (PubChem CID 11340002) has the molecular formula C30H22N4O and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-naphthalen-1-ylbenzonitrile.
| Compound Name | 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-naphthalen-1-ylbenzonitrile |
|---|---|
| PubChem CID | 11340002 |
| Molecular Formula | C30H22N4O |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-naphthalen-1-ylbenzonitrile |
| SMILES | Cn1cncc1C(OCc1ccc(C#N)cc1-c1cccc2ccccc12)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C30H22N4O/c1-34-20-33-18-29(34)30(24-12-9-21(16-31)10-13-24)35-19-25-14-11-22(17-32)15-28(25)27-8-4-6-23-5-2-3-7-26(23)27/h2-15,18,20,30H,19H2,1H3 |
| InChIKey | VHFURXMPOXMFQR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 74.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |