C36H38N4O — CID 10196408
4-[[benzyl-[2-(3-butyl-2,5-diphenylimidazol-4-yl)ethyl]amino]methyl]benzamide (PubChem CID 10196408) has the molecular formula C36H38N4O and a molecular weight of 542.73 g/mol. Its IUPAC name is 4-[[benzyl-[2-(3-butyl-2,5-diphenylimidazol-4-yl)ethyl]amino]methyl]benzamide.
| Compound Name | 4-[[benzyl-[2-(3-butyl-2,5-diphenylimidazol-4-yl)ethyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 10196408 |
| Molecular Formula | C36H38N4O |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | 4-[[benzyl-[2-(3-butyl-2,5-diphenylimidazol-4-yl)ethyl]amino]methyl]benzamide |
| SMILES | CCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1CCN(Cc1ccccc1)Cc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C36H38N4O/c1-2-3-24-40-33(34(30-15-9-5-10-16-30)38-36(40)32-17-11-6-12-18-32)23-25-39(26-28-13-7-4-8-14-28)27-29-19-21-31(22-20-29)35(37)41/h4-22H,2-3,23-27H2,1H3,(H2,37,41) |
| InChIKey | AXEPWOWUCUJRQX-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |