C28H29NO6S — CID 10196432
4-[(E)-3-[4-methoxy-2-(3-morpholin-4-ylpropoxy)-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid (PubChem CID 10196432) has the molecular formula C28H29NO6S and a molecular weight of 507.61 g/mol. Its IUPAC name is 4-[(E)-3-[4-methoxy-2-(3-morpholin-4-ylpropoxy)-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid.
| Compound Name | 4-[(E)-3-[4-methoxy-2-(3-morpholin-4-ylpropoxy)-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 10196432 |
| Molecular Formula | C28H29NO6S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 4-[(E)-3-[4-methoxy-2-(3-morpholin-4-ylpropoxy)-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid |
| SMILES | COc1cc(OCCCN2CCOCC2)c(/C=C/C(=O)c2ccc(C(=O)O)cc2)cc1-c1cccs1 |
| InChI | InChI=1S/C28H29NO6S/c1-33-26-19-25(35-14-3-11-29-12-15-34-16-13-29)22(18-23(26)27-4-2-17-36-27)9-10-24(30)20-5-7-21(8-6-20)28(31)32/h2,4-10,17-19H,3,11-16H2,1H3,(H,31,32)/b10-9+ |
| InChIKey | PJZUFJNXMMXHDK-MDZDMXLPSA-N |
| XLogP | 5.12 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|