C25H46N8O6 — CID 10196529
(2S)-1-[(2S)-2-[[(2R,3S)-2-[[(2S,3S)-2-acetamido-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide (PubChem CID 10196529) has the molecular formula C25H46N8O6 and a molecular weight of 554.69 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2R,3S)-2-[[(2S,3S)-2-acetamido-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[(2R,3S)-2-[[(2S,3S)-2-acetamido-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10196529 |
| Molecular Formula | C25H46N8O6 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2R,3S)-2-[[(2S,3S)-2-acetamido-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](NC(=O)[C@@H](NC(C)=O)[C@H](C)O)[C@@H](C)CC |
| InChI | InChI=1S/C25H46N8O6/c1-6-14(3)19(32-23(38)20(15(4)34)30-16(5)35)22(37)31-17(10-8-12-29-25(26)27)24(39)33-13-9-11-18(33)21(36)28-7-2/h14-15,17-20,34H,6-13H2,1-5H3,(H,28,36)(H,30,35)(H,31,37)(H,32,38)(H4,26,27,29)/t14-,15-,17-,18-,19+,20-/m0/s1 |
| InChIKey | PTQFYHIZBIHSKN-SYVORCANSA-N |
| XLogP | -1.93 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|