C29H53N9O6 — CID 10312386
(2S)-1-[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-(diacetylamino)hexanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide (PubChem CID 10312386) has the molecular formula C29H53N9O6 and a molecular weight of 623.80 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-(diacetylamino)hexanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-(diacetylamino)hexanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10312386 |
| Molecular Formula | C29H53N9O6 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.41 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-(diacetylamino)hexanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](NC(=O)[C@H](CCCCN)N(C(C)=O)C(C)=O)[C@@H](C)CC |
| InChI | InChI=1S/C29H53N9O6/c1-6-18(3)24(36-26(42)23(13-8-9-15-30)38(19(4)39)20(5)40)27(43)35-21(12-10-16-34-29(31)32)28(44)37-17-11-14-22(37)25(41)33-7-2/h18,21-24H,6-17,30H2,1-5H3,(H,33,41)(H,35,43)(H,36,42)(H4,31,32,34)/t18-,21-,22-,23-,24-/m0/s1 |
| InChIKey | JWDOUIYDMHTRFX-NHKCCNDQSA-N |
| XLogP | -0.92 |
| TPSA | 235.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|