C11H9NO3 — CID 10198128
(2,6-dihydroxyphenyl)-(1H-pyrrol-2-yl)methanone (PubChem CID 10198128) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is (2,6-dihydroxyphenyl)-(1H-pyrrol-2-yl)methanone.
| Compound Name | (2,6-dihydroxyphenyl)-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 10198128 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (2,6-dihydroxyphenyl)-(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc[nH]1)c1c(O)cccc1O |
| InChI | InChI=1S/C11H9NO3/c13-8-4-1-5-9(14)10(8)11(15)7-3-2-6-12-7/h1-6,12-14H |
| InChIKey | AHAUQCJBMMUQMB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |