About gold(1+);1H-pyrrole-2-carboxylate
gold(1+);1H-pyrrole-2-carboxylate (PubChem CID 175933038) has the molecular formula C5H4AuNO2
and a molecular weight of 307.06 g/mol. Its IUPAC name is gold(1+);1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | gold(1+);1H-pyrrole-2-carboxylate |
| PubChem CID | 175933038 |
| Molecular Formula | C5H4AuNO2 |
| Molecular Weight | 307.06 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | gold(1+);1H-pyrrole-2-carboxylate |
| SMILES | O=C([O-])c1ccc[nH]1.[Au+] |
| InChI | InChI=1S/C5H5NO2.Au/c7-5(8)4-2-1-3-6-4;/h1-3,6H,(H,7,8);/q;+1/p-1 |
| InChIKey | PSSOBADJURNVGG-UHFFFAOYSA-M |
| XLogP | -0.62 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.06 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze gold(1+);1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);1H-pyrrole-2-carboxylate?
The IUPAC name of gold(1+);1H-pyrrole-2-carboxylate (CID 175933038) is gold(1+);1H-pyrrole-2-carboxylate.
What is the SMILES notation for gold(1+);1H-pyrrole-2-carboxylate?
The canonical SMILES for gold(1+);1H-pyrrole-2-carboxylate is O=C([O-])c1ccc[nH]1.[Au+].
What is the InChIKey of gold(1+);1H-pyrrole-2-carboxylate?
The InChIKey is PSSOBADJURNVGG-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5NO2.Au/c7-5(8)4-2-1-3-6-4;/h1-3,6H,(H,7,8);/q;+1/p-1.
What are the key properties of gold(1+);1H-pyrrole-2-carboxylate?
gold(1+);1H-pyrrole-2-carboxylate has a molecular weight of 307.06 g/mol, XLogP of -0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);1H-pyrrole-2-carboxylate is sourced from PubChem (CID 175933038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).