C12H8Cl6N2O2 — CID 139244757
2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethanone (PubChem CID 139244757) has the molecular formula C12H8Cl6N2O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 139244757 |
| Molecular Formula | C12H8Cl6N2O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 421.87 |
| IUPAC Name | 2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethanone |
| SMILES | O=C(c1ccc[nH]1)C(Cl)(Cl)Cl.O=C(c1ccc[nH]1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/2C6H4Cl3NO/c2*7-6(8,9)5(11)4-2-1-3-10-4/h2*1-3,10H |
| InChIKey | LELGGFKNZAJCIC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|