C7H7Cl2N3O2 — CID 12587939
N'-(2,2-dichloroacetyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 12587939) has the molecular formula C7H7Cl2N3O2 and a molecular weight of 236.06 g/mol. Its IUPAC name is N'-(2,2-dichloroacetyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-(2,2-dichloroacetyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 12587939 |
| Molecular Formula | C7H7Cl2N3O2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | N'-(2,2-dichloroacetyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C(Cl)Cl)c1ccc[nH]1 |
| InChI | InChI=1S/C7H7Cl2N3O2/c8-5(9)7(14)12-11-6(13)4-2-1-3-10-4/h1-3,5,10H,(H,11,13)(H,12,14) |
| InChIKey | IIYLEFWTEITDAM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|