C8H14N4O4 — CID 139040123
[amino-(1H-pyrrole-2-carbonylamino)methylidene]azanium;acetate;hydrate (PubChem CID 139040123) has the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is [amino-(1H-pyrrole-2-carbonylamino)methylidene]azanium;acetate;hydrate.
| Compound Name | [amino-(1H-pyrrole-2-carbonylamino)methylidene]azanium;acetate;hydrate |
|---|---|
| PubChem CID | 139040123 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | [amino-(1H-pyrrole-2-carbonylamino)methylidene]azanium;acetate;hydrate |
| SMILES | CC(=O)[O-].NC(=[NH2+])NC(=O)c1ccc[nH]1.O |
| InChI | InChI=1S/C6H8N4O.C2H4O2.H2O/c7-6(8)10-5(11)4-2-1-3-9-4;1-2(3)4;/h1-3,9H,(H4,7,8,10,11);1H3,(H,3,4);1H2 |
| InChIKey | MPLSVBWUPVLECN-UHFFFAOYSA-N |
| XLogP | -4.25 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|