C14H13N3O5 — CID 23187753
indene-1,2,3-trione;1H-pyrrole-2-carbohydrazide;hydrate (PubChem CID 23187753) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is indene-1,2,3-trione;1H-pyrrole-2-carbohydrazide;hydrate.
| Compound Name | indene-1,2,3-trione;1H-pyrrole-2-carbohydrazide;hydrate |
|---|---|
| PubChem CID | 23187753 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | indene-1,2,3-trione;1H-pyrrole-2-carbohydrazide;hydrate |
| SMILES | NNC(=O)c1ccc[nH]1.O.O=c1c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C9H4O3.C5H7N3O.H2O/c10-7-5-3-1-2-4-6(5)8(11)9(7)12;6-8-5(9)4-2-1-3-7-4;/h1-4H;1-3,7H,6H2,(H,8,9);1H2 |
| InChIKey | PJSFXEGWSMKVFV-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|