C17H16N2O5 — CID 19034309
indene-1,2,3-trione;2-methylbenzohydrazide;hydrate (PubChem CID 19034309) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is indene-1,2,3-trione;2-methylbenzohydrazide;hydrate.
| Compound Name | indene-1,2,3-trione;2-methylbenzohydrazide;hydrate |
|---|---|
| PubChem CID | 19034309 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | indene-1,2,3-trione;2-methylbenzohydrazide;hydrate |
| SMILES | Cc1ccccc1C(=O)NN.O.O=c1c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C9H4O3.C8H10N2O.H2O/c10-7-5-3-1-2-4-6(5)8(11)9(7)12;1-6-4-2-3-5-7(6)8(11)10-9;/h1-4H;2-5H,9H2,1H3,(H,10,11);1H2 |
| InChIKey | OWPMGWCNDBEILZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 137.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|