C18H19ClFNO5 — CID 10199999
ethyl 5-[1-(2-chloro-4-fluoroanilino)-2-ethoxy-2-oxoethyl]-2-methylfuran-3-carboxylate (PubChem CID 10199999) has the molecular formula C18H19ClFNO5 and a molecular weight of 383.80 g/mol. Its IUPAC name is ethyl 5-[1-(2-chloro-4-fluoroanilino)-2-ethoxy-2-oxoethyl]-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 5-[1-(2-chloro-4-fluoroanilino)-2-ethoxy-2-oxoethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 10199999 |
| Molecular Formula | C18H19ClFNO5 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | ethyl 5-[1-(2-chloro-4-fluoroanilino)-2-ethoxy-2-oxoethyl]-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(Nc2ccc(F)cc2Cl)C(=O)OCC)oc1C |
| InChI | InChI=1S/C18H19ClFNO5/c1-4-24-17(22)12-9-15(26-10(12)3)16(18(23)25-5-2)21-14-7-6-11(20)8-13(14)19/h6-9,16,21H,4-5H2,1-3H3 |
| InChIKey | NVBMLSOGDQFATR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |