C22H27NO3 — CID 102000068
[(1R)-1-ethynyl-12a-methyl-7-oxo-3,3a,3b,4,5,8,9,10,11,12-decahydro-2H-indeno[4,5-i][3]benzazepin-1-yl] acetate (PubChem CID 102000068) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is [(1R)-1-ethynyl-12a-methyl-7-oxo-3,3a,3b,4,5,8,9,10,11,12-decahydro-2H-indeno[4,5-i][3]benzazepin-1-yl] acetate.
| Compound Name | [(1R)-1-ethynyl-12a-methyl-7-oxo-3,3a,3b,4,5,8,9,10,11,12-decahydro-2H-indeno[4,5-i][3]benzazepin-1-yl] acetate |
|---|---|
| PubChem CID | 102000068 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [(1R)-1-ethynyl-12a-methyl-7-oxo-3,3a,3b,4,5,8,9,10,11,12-decahydro-2H-indeno[4,5-i][3]benzazepin-1-yl] acetate |
| SMILES | C#C[C@]1(OC(C)=O)CCC2C3CCC4=CC(=O)NCCC4=C3CCC21C |
| InChI | InChI=1S/C22H27NO3/c1-4-22(26-14(2)24)11-8-19-18-6-5-15-13-20(25)23-12-9-16(15)17(18)7-10-21(19,22)3/h1,13,18-19H,5-12H2,2-3H3,(H,23,25)/t18?,19?,21?,22-/m0/s1 |
| InChIKey | AKBJOHMECYMIQA-MMOSCBCDSA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|