C10H16O4 — CID 102000897
(3R,3aR,6R,6aR)-3-methoxy-6-[(Z)-prop-1-enoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 102000897) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-3-methoxy-6-[(Z)-prop-1-enoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3R,3aR,6R,6aR)-3-methoxy-6-[(Z)-prop-1-enoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 102000897 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (3R,3aR,6R,6aR)-3-methoxy-6-[(Z)-prop-1-enoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C/C=C\O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OC |
| InChI | InChI=1S/C10H16O4/c1-3-4-12-8-6-14-9-7(11-2)5-13-10(8)9/h3-4,7-10H,5-6H2,1-2H3/b4-3-/t7-,8-,9-,10-/m1/s1 |
| InChIKey | VHTOEVFHNBPVLM-RQRGRJPXSA-N |
| XLogP | 0.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|