C10H14O4 — CID 66760273
(3S,3aR,6R,6aR)-3,6-bis(ethenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 66760273) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3,6-bis(ethenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6R,6aR)-3,6-bis(ethenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 66760273 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3S,3aR,6R,6aR)-3,6-bis(ethenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C=CO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC=C |
| InChI | InChI=1S/C10H14O4/c1-3-11-7-5-13-10-8(12-4-2)6-14-9(7)10/h3-4,7-10H,1-2,5-6H2/t7-,8+,9-,10-/m1/s1 |
| InChIKey | HZOGFLPBYPXACG-UTINFBMNSA-N |
| XLogP | 0.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|