C18H30O2 — CID 102001195
(3aR,5E,8S,9E,12aR)-8-(methoxymethoxy)-6,10-dimethyl-1,2,3,3a,4,7,8,11,12,12a-decahydrocyclopenta[11]annulene (PubChem CID 102001195) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (3aR,5E,8S,9E,12aR)-8-(methoxymethoxy)-6,10-dimethyl-1,2,3,3a,4,7,8,11,12,12a-decahydrocyclopenta[11]annulene.
| Compound Name | (3aR,5E,8S,9E,12aR)-8-(methoxymethoxy)-6,10-dimethyl-1,2,3,3a,4,7,8,11,12,12a-decahydrocyclopenta[11]annulene |
|---|---|
| PubChem CID | 102001195 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (3aR,5E,8S,9E,12aR)-8-(methoxymethoxy)-6,10-dimethyl-1,2,3,3a,4,7,8,11,12,12a-decahydrocyclopenta[11]annulene |
| SMILES | COCO[C@@H]1/C=C(\C)CC[C@H]2CCC[C@@H]2C/C=C(\C)C1 |
| InChI | InChI=1S/C18H30O2/c1-14-7-9-16-5-4-6-17(16)10-8-15(2)12-18(11-14)20-13-19-3/h7,12,16-18H,4-6,8-11,13H2,1-3H3/b14-7+,15-12+/t16-,17-,18+/m1/s1 |
| InChIKey | ADLMIIUEGYPLEE-SDUQZQMUSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|