C13H20O — CID 23243128
2-[(1R,4aS,8aR)-7-methyl-1,4,4a,5,6,8a-hexahydronaphthalen-1-yl]ethanol (PubChem CID 23243128) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-[(1R,4aS,8aR)-7-methyl-1,4,4a,5,6,8a-hexahydronaphthalen-1-yl]ethanol.
| Compound Name | 2-[(1R,4aS,8aR)-7-methyl-1,4,4a,5,6,8a-hexahydronaphthalen-1-yl]ethanol |
|---|---|
| PubChem CID | 23243128 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-[(1R,4aS,8aR)-7-methyl-1,4,4a,5,6,8a-hexahydronaphthalen-1-yl]ethanol |
| SMILES | CC1=C[C@@H]2[C@H](CC=C[C@H]2CCO)CC1 |
| InChI | InChI=1S/C13H20O/c1-10-5-6-11-3-2-4-12(7-8-14)13(11)9-10/h2,4,9,11-14H,3,5-8H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | FLIVMNYBDRMLML-FRRDWIJNSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|