C34H32N4O6 — CID 102002278
7,15-dibenzyl-3,19-dioxa-7,15,25,26-tetrazatricyclo[19.3.1.19,13]hexacosa-1(25),9(26),10,12,21,23-hexaene-2,8,14,20-tetrone (PubChem CID 102002278) has the molecular formula C34H32N4O6 and a molecular weight of 592.65 g/mol. Its IUPAC name is 7,15-dibenzyl-3,19-dioxa-7,15,25,26-tetrazatricyclo[19.3.1.19,13]hexacosa-1(25),9(26),10,12,21,23-hexaene-2,8,14,20-tetrone.
| Compound Name | 7,15-dibenzyl-3,19-dioxa-7,15,25,26-tetrazatricyclo[19.3.1.19,13]hexacosa-1(25),9(26),10,12,21,23-hexaene-2,8,14,20-tetrone |
|---|---|
| PubChem CID | 102002278 |
| Molecular Formula | C34H32N4O6 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 7,15-dibenzyl-3,19-dioxa-7,15,25,26-tetrazatricyclo[19.3.1.19,13]hexacosa-1(25),9(26),10,12,21,23-hexaene-2,8,14,20-tetrone |
| SMILES | O=C1OCCCN(Cc2ccccc2)C(=O)c2cccc(n2)C(=O)N(Cc2ccccc2)CCCOC(=O)c2cccc1n2 |
| InChI | InChI=1S/C34H32N4O6/c39-31-27-15-7-16-28(35-27)32(40)38(24-26-13-5-2-6-14-26)20-10-22-44-34(42)30-18-8-17-29(36-30)33(41)43-21-9-19-37(31)23-25-11-3-1-4-12-25/h1-8,11-18H,9-10,19-24H2 |
| InChIKey | SPBDZBGAJTYWQQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 119.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |