C15H19N — CID 102006219
(1R,2R,4S,6R)-6-[(E)-2-phenylethenyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 102006219) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (1R,2R,4S,6R)-6-[(E)-2-phenylethenyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,4S,6R)-6-[(E)-2-phenylethenyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 102006219 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (1R,2R,4S,6R)-6-[(E)-2-phenylethenyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | N[C@@H]1C[C@@H]2C[C@@H]1[C@@H](/C=C/c1ccccc1)C2 |
| InChI | InChI=1S/C15H19N/c16-15-10-12-8-13(14(15)9-12)7-6-11-4-2-1-3-5-11/h1-7,12-15H,8-10,16H2/b7-6+/t12-,13-,14+,15+/m0/s1 |
| InChIKey | MGFIISDTOBSGES-MTHZGQEKSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |