C27H35FN4O3 — CID 102006474
tert-butyl N-[1-[2-[[(1R,2S)-6-fluoro-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-2-oxoethyl]pyrrolidin-3-yl]carbamate (PubChem CID 102006474) has the molecular formula C27H35FN4O3 and a molecular weight of 482.60 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[[(1R,2S)-6-fluoro-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-2-oxoethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[[(1R,2S)-6-fluoro-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-2-oxoethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 102006474 |
| Molecular Formula | C27H35FN4O3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | tert-butyl N-[1-[2-[[(1R,2S)-6-fluoro-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-2-oxoethyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC(=O)N[C@H]2CCc3cc(F)ccc3[C@H]2Cc2cccnc2)C1 |
| InChI | InChI=1S/C27H35FN4O3/c1-27(2,3)35-26(34)30-21-10-12-32(16-21)17-25(33)31-24-9-6-19-14-20(28)7-8-22(19)23(24)13-18-5-4-11-29-15-18/h4-5,7-8,11,14-15,21,23-24H,6,9-10,12-13,16-17H2,1-3H3,(H,30,34)(H,31,33)/t21?,23-,24+/m1/s1 |
| InChIKey | KRHQOBKALSRNJX-RSOKHERMSA-N |
| XLogP | 3.58 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |