C18H20 — CID 102007306
(1S,2R)-2-[2-(cyclohexen-1-yl)ethynyl]-1-methyl-2,3-dihydro-1H-indene (PubChem CID 102007306) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is (1S,2R)-2-[2-(cyclohexen-1-yl)ethynyl]-1-methyl-2,3-dihydro-1H-indene.
| Compound Name | (1S,2R)-2-[2-(cyclohexen-1-yl)ethynyl]-1-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 102007306 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1S,2R)-2-[2-(cyclohexen-1-yl)ethynyl]-1-methyl-2,3-dihydro-1H-indene |
| SMILES | C[C@@H]1c2ccccc2C[C@H]1C#CC1=CCCCC1 |
| InChI | InChI=1S/C18H20/c1-14-16(12-11-15-7-3-2-4-8-15)13-17-9-5-6-10-18(14)17/h5-7,9-10,14,16H,2-4,8,13H2,1H3/t14-,16+/m0/s1 |
| InChIKey | VNXYPDJEJQDAKF-GOEBONIOSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|