C22H26N3O2+ — CID 102007998
(3S)-3-methyl-N-[2-[2-(1-methylpyridin-1-ium-3-yl)-1H-indol-3-yl]ethyl]-2-oxopentanamide (PubChem CID 102007998) has the molecular formula C22H26N3O2+ and a molecular weight of 364.47 g/mol. Its IUPAC name is (3S)-3-methyl-N-[2-[2-(1-methylpyridin-1-ium-3-yl)-1H-indol-3-yl]ethyl]-2-oxopentanamide.
| Compound Name | (3S)-3-methyl-N-[2-[2-(1-methylpyridin-1-ium-3-yl)-1H-indol-3-yl]ethyl]-2-oxopentanamide |
|---|---|
| PubChem CID | 102007998 |
| Molecular Formula | C22H26N3O2+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (3S)-3-methyl-N-[2-[2-(1-methylpyridin-1-ium-3-yl)-1H-indol-3-yl]ethyl]-2-oxopentanamide |
| SMILES | CC[C@H](C)C(=O)C(=O)NCCc1c(-c2ccc[n+](C)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H25N3O2/c1-4-15(2)21(26)22(27)23-12-11-18-17-9-5-6-10-19(17)24-20(18)16-8-7-13-25(3)14-16/h5-10,13-15,24H,4,11-12H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | RJHIMMDZJXBPIL-HNNXBMFYSA-O |
| XLogP | 2.93 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|