C23H32O6 — CID 102011499
tert-butyl (E)-4-[3-[(E)-hept-2-enyl]-4-(hydroxymethyl)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoate (PubChem CID 102011499) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is tert-butyl (E)-4-[3-[(E)-hept-2-enyl]-4-(hydroxymethyl)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoate.
| Compound Name | tert-butyl (E)-4-[3-[(E)-hept-2-enyl]-4-(hydroxymethyl)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 102011499 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | tert-butyl (E)-4-[3-[(E)-hept-2-enyl]-4-(hydroxymethyl)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoate |
| SMILES | CCCC/C=C/CC1=C(CO)C(=O)C2OC2(C/C=C(\C)C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C23H32O6/c1-6-7-8-9-10-11-16-17(14-24)18(25)20-23(28-20,19(16)26)13-12-15(2)21(27)29-22(3,4)5/h9-10,12,20,24H,6-8,11,13-14H2,1-5H3/b10-9+,15-12+ |
| InChIKey | IQCUHJHYCXACJT-MKQCFFQWSA-N |
| XLogP | 3.38 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|