C22H30O6 — CID 74429150
4-(3-hept-1-enyl-6,6-dimethyl-2-oxo-7a,7b-dihydro-4H-oxireno[2,3-h][1,3]benzodioxin-1a-yl)-2-methylbut-2-enoic acid (PubChem CID 74429150) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-(3-hept-1-enyl-6,6-dimethyl-2-oxo-7a,7b-dihydro-4H-oxireno[2,3-h][1,3]benzodioxin-1a-yl)-2-methylbut-2-enoic acid.
| Compound Name | 4-(3-hept-1-enyl-6,6-dimethyl-2-oxo-7a,7b-dihydro-4H-oxireno[2,3-h][1,3]benzodioxin-1a-yl)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 74429150 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 4-(3-hept-1-enyl-6,6-dimethyl-2-oxo-7a,7b-dihydro-4H-oxireno[2,3-h][1,3]benzodioxin-1a-yl)-2-methylbut-2-enoic acid |
| SMILES | CCCCCC=CC1=C2COC(C)(C)OC2C2OC2(CC=C(C)C(=O)O)C1=O |
| InChI | InChI=1S/C22H30O6/c1-5-6-7-8-9-10-15-16-13-26-21(3,4)27-17(16)19-22(28-19,18(15)23)12-11-14(2)20(24)25/h9-11,17,19H,5-8,12-13H2,1-4H3,(H,24,25) |
| InChIKey | KJESBKJFNPXHOA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|