C11H16O2 — CID 102011600
trans-(2S,6R)-2-ethenyl-2-hydroxy-6-prop-2-enylcyclohexan-1-one (PubChem CID 102011600) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is trans-(2S,6R)-2-ethenyl-2-hydroxy-6-prop-2-enylcyclohexan-1-one.
| Compound Name | trans-(2S,6R)-2-ethenyl-2-hydroxy-6-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 102011600 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | trans-(2S,6R)-2-ethenyl-2-hydroxy-6-prop-2-enylcyclohexan-1-one |
| SMILES | C=CC[C@H]1CCC[C@](O)(C=C)C1=O |
| InChI | InChI=1S/C11H16O2/c1-3-6-9-7-5-8-11(13,4-2)10(9)12/h3-4,9,13H,1-2,5-8H2/t9-,11+/m0/s1 |
| InChIKey | VWDXQWDAKBGMCL-GXSJLCMTSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|