C17H25NO4Si — CID 102012082
methyl 3-(3-phenyl-1-trimethylsilyloxypropyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 102012082) has the molecular formula C17H25NO4Si and a molecular weight of 335.48 g/mol. Its IUPAC name is methyl 3-(3-phenyl-1-trimethylsilyloxypropyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-(3-phenyl-1-trimethylsilyloxypropyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 102012082 |
| Molecular Formula | C17H25NO4Si |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | methyl 3-(3-phenyl-1-trimethylsilyloxypropyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1CC(C(CCc2ccccc2)O[Si](C)(C)C)=NO1 |
| InChI | InChI=1S/C17H25NO4Si/c1-20-17(19)16-12-14(18-21-16)15(22-23(2,3)4)11-10-13-8-6-5-7-9-13/h5-9,15-16H,10-12H2,1-4H3 |
| InChIKey | ZMFGXSWFQCEZME-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|