About CID 102012562
CID 102012562 (PubChem CID 102012562) has the molecular formula C12H14NO
and a molecular weight of 188.25 g/mol.
Molecular Properties
| Compound Name | CID 102012562 |
| PubChem CID | 102012562 |
| Molecular Formula | C12H14NO |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | — |
| SMILES | C=CC[CH]N(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14NO/c1-3-4-10-13(2)12(14)11-8-6-5-7-9-11/h3,5-10H,1,4H2,2H3 |
| InChIKey | SGGGHBKMPSHHKM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 102012562 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102012562?
The IUPAC name of CID 102012562 (CID 102012562) is not available.
What is the SMILES notation for CID 102012562?
The canonical SMILES for CID 102012562 is C=CC[CH]N(C)C(=O)c1ccccc1.
What is the InChIKey of CID 102012562?
The InChIKey is SGGGHBKMPSHHKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14NO/c1-3-4-10-13(2)12(14)11-8-6-5-7-9-11/h3,5-10H,1,4H2,2H3.
What are the key properties of CID 102012562?
CID 102012562 has a molecular weight of 188.25 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102012562 is sourced from PubChem (CID 102012562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).