C10H12NP — CID 102014448
(2,4,6-trimethylphenyl)phosphanylformonitrile (PubChem CID 102014448) has the molecular formula C10H12NP and a molecular weight of 177.19 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)phosphanylformonitrile.
| Compound Name | (2,4,6-trimethylphenyl)phosphanylformonitrile |
|---|---|
| PubChem CID | 102014448 |
| Molecular Formula | C10H12NP |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | (2,4,6-trimethylphenyl)phosphanylformonitrile |
| SMILES | Cc1cc(C)c(PC#N)c(C)c1 |
| InChI | InChI=1S/C10H12NP/c1-7-4-8(2)10(12-6-11)9(3)5-7/h4-5,12H,1-3H3 |
| InChIKey | VZIZKXVGAKBLDA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|