C22H26N4O5 — CID 102015915
methyl 4-[4-[benzyl(methyl)carbamoyl]-1,4-diazepan-1-yl]-3-nitrobenzoate (PubChem CID 102015915) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is methyl 4-[4-[benzyl(methyl)carbamoyl]-1,4-diazepan-1-yl]-3-nitrobenzoate.
| Compound Name | methyl 4-[4-[benzyl(methyl)carbamoyl]-1,4-diazepan-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 102015915 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | methyl 4-[4-[benzyl(methyl)carbamoyl]-1,4-diazepan-1-yl]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(N2CCCN(C(=O)N(C)Cc3ccccc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H26N4O5/c1-23(16-17-7-4-3-5-8-17)22(28)25-12-6-11-24(13-14-25)19-10-9-18(21(27)31-2)15-20(19)26(29)30/h3-5,7-10,15H,6,11-14,16H2,1-2H3 |
| InChIKey | XUMJNLHRBYXONW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|