C14H27NO — CID 102019648
(E)-N,N-diethyl-2-methylnon-2-enamide (PubChem CID 102019648) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is (E)-N,N-diethyl-2-methylnon-2-enamide.
| Compound Name | (E)-N,N-diethyl-2-methylnon-2-enamide |
|---|---|
| PubChem CID | 102019648 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (E)-N,N-diethyl-2-methylnon-2-enamide |
| SMILES | CCCCCC/C=C(\C)C(=O)N(CC)CC |
| InChI | InChI=1S/C14H27NO/c1-5-8-9-10-11-12-13(4)14(16)15(6-2)7-3/h12H,5-11H2,1-4H3/b13-12+ |
| InChIKey | LSINVGBZEUMHDS-OUKQBFOZSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|