C18H32F3NO — CID 10520811
(Z)-N,N-dibutyl-2-(trifluoromethyl)non-2-enamide (PubChem CID 10520811) has the molecular formula C18H32F3NO and a molecular weight of 335.45 g/mol. Its IUPAC name is (Z)-N,N-dibutyl-2-(trifluoromethyl)non-2-enamide.
| Compound Name | (Z)-N,N-dibutyl-2-(trifluoromethyl)non-2-enamide |
|---|---|
| PubChem CID | 10520811 |
| Molecular Formula | C18H32F3NO |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | (Z)-N,N-dibutyl-2-(trifluoromethyl)non-2-enamide |
| SMILES | CCCCCC/C=C(/C(=O)N(CCCC)CCCC)C(F)(F)F |
| InChI | InChI=1S/C18H32F3NO/c1-4-7-10-11-12-13-16(18(19,20)21)17(23)22(14-8-5-2)15-9-6-3/h13H,4-12,14-15H2,1-3H3/b16-13- |
| InChIKey | PSGXZQMCCCJRHT-SSZFMOIBSA-N |
| XLogP | 5.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|